About [(2R)-oxan-2-yl]methyl methanesulfonate
[(2R)-oxan-2-yl]methyl methanesulfonate (PubChem CID 86621777) has the molecular formula C7H14O4S
and a molecular weight of 194.25 g/mol. Its IUPAC name is [(2R)-oxan-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(2R)-oxan-2-yl]methyl methanesulfonate |
| PubChem CID | 86621777 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | [(2R)-oxan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CCCCO1 |
| InChI | InChI=1S/C7H14O4S/c1-12(8,9)11-6-7-4-2-3-5-10-7/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | MFCJQPGABLDBKD-SSDOTTSWSA-N |
| XLogP | 0.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxan-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxan-2-yl]methyl methanesulfonate?
The IUPAC name of [(2R)-oxan-2-yl]methyl methanesulfonate (CID 86621777) is [(2R)-oxan-2-yl]methyl methanesulfonate.
What is the SMILES notation for [(2R)-oxan-2-yl]methyl methanesulfonate?
The canonical SMILES for [(2R)-oxan-2-yl]methyl methanesulfonate is CS(=O)(=O)OC[C@H]1CCCCO1.
What is the InChIKey of [(2R)-oxan-2-yl]methyl methanesulfonate?
The InChIKey is MFCJQPGABLDBKD-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H14O4S/c1-12(8,9)11-6-7-4-2-3-5-10-7/h7H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of [(2R)-oxan-2-yl]methyl methanesulfonate?
[(2R)-oxan-2-yl]methyl methanesulfonate has a molecular weight of 194.25 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxan-2-yl]methyl methanesulfonate is sourced from PubChem (CID 86621777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).