About [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate
[(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate (PubChem CID 40895496) has the molecular formula C11H13ClO4S
and a molecular weight of 276.74 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate |
| PubChem CID | 40895496 |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(OC[C@H]1CCCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO4S/c12-9-3-5-11(6-4-9)17(13,14)16-8-10-2-1-7-15-10/h3-6,10H,1-2,7-8H2/t10-/m1/s1 |
| InChIKey | SVZUCPOTYAPYJP-SNVBAGLBSA-N |
| XLogP | 2.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate?
The IUPAC name of [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate (CID 40895496) is [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate.
What is the SMILES notation for [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate?
The canonical SMILES for [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate is O=S(=O)(OC[C@H]1CCCO1)c1ccc(Cl)cc1.
What is the InChIKey of [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate?
The InChIKey is SVZUCPOTYAPYJP-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H13ClO4S/c12-9-3-5-11(6-4-9)17(13,14)16-8-10-2-1-7-15-10/h3-6,10H,1-2,7-8H2/t10-/m1/s1.
What are the key properties of [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate?
[(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate has a molecular weight of 276.74 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxolan-2-yl]methyl 4-chlorobenzenesulfonate is sourced from PubChem (CID 40895496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).