C11H13Cl2NO4S — CID 43342542
2,3-dichloro-4-(oxolan-2-ylmethoxy)benzenesulfonamide (PubChem CID 43342542) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 2,3-dichloro-4-(oxolan-2-ylmethoxy)benzenesulfonamide.
| Compound Name | 2,3-dichloro-4-(oxolan-2-ylmethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43342542 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2,3-dichloro-4-(oxolan-2-ylmethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC2CCCO2)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S/c12-10-8(18-6-7-2-1-5-17-7)3-4-9(11(10)13)19(14,15)16/h3-4,7H,1-2,5-6H2,(H2,14,15,16) |
| InChIKey | GJXDFHZOUUTBQG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |