C11H11Cl3O2 — CID 112779327
2-[(2,4,5-trichlorophenoxy)methyl]oxolane (PubChem CID 112779327) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 2-[(2,4,5-trichlorophenoxy)methyl]oxolane.
| Compound Name | 2-[(2,4,5-trichlorophenoxy)methyl]oxolane |
|---|---|
| PubChem CID | 112779327 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2-[(2,4,5-trichlorophenoxy)methyl]oxolane |
| SMILES | Clc1cc(Cl)c(OCC2CCCO2)cc1Cl |
| InChI | InChI=1S/C11H11Cl3O2/c12-8-4-10(14)11(5-9(8)13)16-6-7-2-1-3-15-7/h4-5,7H,1-3,6H2 |
| InChIKey | KRJZRBWXFQOJOV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|