C12H11Cl3O4 — CID 62299393
5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carboxylic acid (PubChem CID 62299393) has the molecular formula C12H11Cl3O4 and a molecular weight of 325.58 g/mol. Its IUPAC name is 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62299393 |
| Molecular Formula | C12H11Cl3O4 |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(COc2cc(Cl)c(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C12H11Cl3O4/c13-7-3-9(15)11(4-8(7)14)18-5-6-1-2-10(19-6)12(16)17/h3-4,6,10H,1-2,5H2,(H,16,17) |
| InChIKey | WZEGDXRPEDFSNG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|