5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid

C14H18O4 — CID 62299571

IUPAC5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid
SMILESCc1ccc(OCC2CCC(C(=O)O)O2)cc1C
InChIInChI=1S/C14H18O4/c1-9-3-4-11(7-10(9)2)17-8-12-5-6-13(18-12)14(15)16/h3-4,7,12-13H,5-6,8H2,1-2H3,(H,15,16)
InChIKeySQYPJGUHWHWFOZ-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.31
Rot. Bonds4

About 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid

5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid (PubChem CID 62299571) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid.

Molecular Properties

Compound Name5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid
PubChem CID62299571
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Name5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid
SMILESCc1ccc(OCC2CCC(C(=O)O)O2)cc1C
InChIInChI=1S/C14H18O4/c1-9-3-4-11(7-10(9)2)17-8-12-5-6-13(18-12)14(15)16/h3-4,7,12-13H,5-6,8H2,1-2H3,(H,15,16)
InChIKeySQYPJGUHWHWFOZ-UHFFFAOYSA-N
XLogP2.31
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid (CID 62299571) is 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid is Cc1ccc(OCC2CCC(C(=O)O)O2)cc1C.
What is the InChIKey of 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid?
The InChIKey is SQYPJGUHWHWFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-9-3-4-11(7-10(9)2)17-8-12-5-6-13(18-12)14(15)16/h3-4,7,12-13H,5-6,8H2,1-2H3,(H,15,16).
What are the key properties of 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid?
5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid has a molecular weight of 250.29 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethylphenoxy)methyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 62299571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).