C16H20O5 — CID 62301158
5-[[4-(3-oxobutyl)phenoxy]methyl]oxolane-2-carboxylic acid (PubChem CID 62301158) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 5-[[4-(3-oxobutyl)phenoxy]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[4-(3-oxobutyl)phenoxy]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62301158 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 5-[[4-(3-oxobutyl)phenoxy]methyl]oxolane-2-carboxylic acid |
| SMILES | CC(=O)CCc1ccc(OCC2CCC(C(=O)O)O2)cc1 |
| InChI | InChI=1S/C16H20O5/c1-11(17)2-3-12-4-6-13(7-5-12)20-10-14-8-9-15(21-14)16(18)19/h4-7,14-15H,2-3,8-10H2,1H3,(H,18,19) |
| InChIKey | MKJFWYPFTSRDJK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |