C12H13Cl3N2O3 — CID 63576364
5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carbohydrazide (PubChem CID 63576364) has the molecular formula C12H13Cl3N2O3 and a molecular weight of 339.61 g/mol. Its IUPAC name is 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63576364 |
| Molecular Formula | C12H13Cl3N2O3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 5-[(2,4,5-trichlorophenoxy)methyl]oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(COc2cc(Cl)c(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C12H13Cl3N2O3/c13-7-3-9(15)11(4-8(7)14)19-5-6-1-2-10(20-6)12(18)17-16/h3-4,6,10H,1-2,5,16H2,(H,17,18) |
| InChIKey | BONVYKHXRHNVNM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|