C14H20N2O4 — CID 63574989
5-[(2-methoxy-4-methylphenoxy)methyl]oxolane-2-carbohydrazide (PubChem CID 63574989) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-[(2-methoxy-4-methylphenoxy)methyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(2-methoxy-4-methylphenoxy)methyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63574989 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-[(2-methoxy-4-methylphenoxy)methyl]oxolane-2-carbohydrazide |
| SMILES | COc1cc(C)ccc1OCC1CCC(C(=O)NN)O1 |
| InChI | InChI=1S/C14H20N2O4/c1-9-3-5-11(13(7-9)18-2)19-8-10-4-6-12(20-10)14(17)16-15/h3,5,7,10,12H,4,6,8,15H2,1-2H3,(H,16,17) |
| InChIKey | YZRWHMXNVDVTNU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|