C13H16FN3O4 — CID 63568919
2-fluoro-6-[[5-(hydrazinecarbonyl)oxolan-2-yl]methoxy]benzamide (PubChem CID 63568919) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-fluoro-6-[[5-(hydrazinecarbonyl)oxolan-2-yl]methoxy]benzamide.
| Compound Name | 2-fluoro-6-[[5-(hydrazinecarbonyl)oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 63568919 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-fluoro-6-[[5-(hydrazinecarbonyl)oxolan-2-yl]methoxy]benzamide |
| SMILES | NNC(=O)C1CCC(COc2cccc(F)c2C(N)=O)O1 |
| InChI | InChI=1S/C13H16FN3O4/c14-8-2-1-3-9(11(8)12(15)18)20-6-7-4-5-10(21-7)13(19)17-16/h1-3,7,10H,4-6,16H2,(H2,15,18)(H,17,19) |
| InChIKey | ZGFZRQLLCAEVNT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|