C14H16Cl2O6S — CID 88611367
[(2S)-oxolan-2-yl]methyl 2-(2,5-dichlorophenyl)sulfonyloxypropanoate (PubChem CID 88611367) has the molecular formula C14H16Cl2O6S and a molecular weight of 383.25 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 2-(2,5-dichlorophenyl)sulfonyloxypropanoate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 2-(2,5-dichlorophenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 88611367 |
| Molecular Formula | C14H16Cl2O6S |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 2-(2,5-dichlorophenyl)sulfonyloxypropanoate |
| SMILES | CC(OS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H16Cl2O6S/c1-9(14(17)21-8-11-3-2-6-20-11)22-23(18,19)13-7-10(15)4-5-12(13)16/h4-5,7,9,11H,2-3,6,8H2,1H3/t9?,11-/m0/s1 |
| InChIKey | AMXHZUVPXLODKE-UMJHXOGRSA-N |
| XLogP | 2.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|