C14H15Cl3O6S — CID 88611400
[(2S)-oxolan-2-yl]methyl 2-(2,4,5-trichlorophenyl)sulfonyloxypropanoate (PubChem CID 88611400) has the molecular formula C14H15Cl3O6S and a molecular weight of 417.69 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 2-(2,4,5-trichlorophenyl)sulfonyloxypropanoate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 2-(2,4,5-trichlorophenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 88611400 |
| Molecular Formula | C14H15Cl3O6S |
| Molecular Weight | 417.69 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 2-(2,4,5-trichlorophenyl)sulfonyloxypropanoate |
| SMILES | CC(OS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl)C(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H15Cl3O6S/c1-8(14(18)22-7-9-3-2-4-21-9)23-24(19,20)13-6-11(16)10(15)5-12(13)17/h5-6,8-9H,2-4,7H2,1H3/t8?,9-/m0/s1 |
| InChIKey | ZHMBGNKAMKAXJA-GKAPJAKFSA-N |
| XLogP | 3.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|