C14H16ClNO8S — CID 88611405
oxolan-2-ylmethyl (2S)-2-(4-chloro-3-nitrophenyl)sulfonyloxypropanoate (PubChem CID 88611405) has the molecular formula C14H16ClNO8S and a molecular weight of 393.80 g/mol. Its IUPAC name is oxolan-2-ylmethyl (2S)-2-(4-chloro-3-nitrophenyl)sulfonyloxypropanoate.
| Compound Name | oxolan-2-ylmethyl (2S)-2-(4-chloro-3-nitrophenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 88611405 |
| Molecular Formula | C14H16ClNO8S |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | oxolan-2-ylmethyl (2S)-2-(4-chloro-3-nitrophenyl)sulfonyloxypropanoate |
| SMILES | C[C@H](OS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C14H16ClNO8S/c1-9(14(17)23-8-10-3-2-6-22-10)24-25(20,21)11-4-5-12(15)13(7-11)16(18)19/h4-5,7,9-10H,2-3,6,8H2,1H3/t9-,10?/m0/s1 |
| InChIKey | OTIPJVXZENBWQK-RGURZIINSA-N |
| XLogP | 2.06 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|