About [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate
[(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate (PubChem CID 88611358) has the molecular formula C10H18O6S
and a molecular weight of 266.31 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate.
Molecular Properties
| Compound Name | [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate |
| PubChem CID | 88611358 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate |
| SMILES | CCS(=O)(=O)OC(C)C(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C10H18O6S/c1-3-17(12,13)16-8(2)10(11)15-7-9-5-4-6-14-9/h8-9H,3-7H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | NPBPVFYWEUAQFN-GKAPJAKFSA-N |
| XLogP | 0.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate?
The IUPAC name of [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate (CID 88611358) is [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate.
What is the SMILES notation for [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate?
The canonical SMILES for [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate is CCS(=O)(=O)OC(C)C(=O)OC[C@@H]1CCCO1.
What is the InChIKey of [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate?
The InChIKey is NPBPVFYWEUAQFN-GKAPJAKFSA-N. The full InChI is InChI=1S/C10H18O6S/c1-3-17(12,13)16-8(2)10(11)15-7-9-5-4-6-14-9/h8-9H,3-7H2,1-2H3/t8?,9-/m0/s1.
What are the key properties of [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate?
[(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate has a molecular weight of 266.31 g/mol, XLogP of 0.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxolan-2-yl]methyl 2-ethylsulfonyloxypropanoate is sourced from PubChem (CID 88611358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).