About 2-(oxan-2-ylmethyl)oxane
2-(oxan-2-ylmethyl)oxane (PubChem CID 67860654) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(oxan-2-ylmethyl)oxane.
Molecular Properties
| Compound Name | 2-(oxan-2-ylmethyl)oxane |
| PubChem CID | 67860654 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-(oxan-2-ylmethyl)oxane |
| SMILES | C1CCC(CC2CCCCO2)OC1 |
| InChI | InChI=1S/C11H20O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13-11/h10-11H,1-9H2 |
| InChIKey | ICNLOOMYBMTZQW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxan-2-ylmethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-ylmethyl)oxane?
The IUPAC name of 2-(oxan-2-ylmethyl)oxane (CID 67860654) is 2-(oxan-2-ylmethyl)oxane.
What is the SMILES notation for 2-(oxan-2-ylmethyl)oxane?
The canonical SMILES for 2-(oxan-2-ylmethyl)oxane is C1CCC(CC2CCCCO2)OC1.
What is the InChIKey of 2-(oxan-2-ylmethyl)oxane?
The InChIKey is ICNLOOMYBMTZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13-11/h10-11H,1-9H2.
What are the key properties of 2-(oxan-2-ylmethyl)oxane?
2-(oxan-2-ylmethyl)oxane has a molecular weight of 184.28 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-ylmethyl)oxane is sourced from PubChem (CID 67860654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).