About CID 142148322
CID 142148322 (PubChem CID 142148322) has the molecular formula C10H18BO2
and a molecular weight of 181.06 g/mol.
Molecular Properties
| Compound Name | CID 142148322 |
| PubChem CID | 142148322 |
| Molecular Formula | C10H18BO2 |
| Molecular Weight | 181.06 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | — |
| SMILES | [B]1CCCOC1CC1CCCCO1 |
| InChI | InChI=1S/C10H18BO2/c1-2-6-12-9(4-1)8-10-11-5-3-7-13-10/h9-10H,1-8H2 |
| InChIKey | OSFDSFRQHUXFOF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142148322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142148322?
The IUPAC name of CID 142148322 (CID 142148322) is not available.
What is the SMILES notation for CID 142148322?
The canonical SMILES for CID 142148322 is [B]1CCCOC1CC1CCCCO1.
What is the InChIKey of CID 142148322?
The InChIKey is OSFDSFRQHUXFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BO2/c1-2-6-12-9(4-1)8-10-11-5-3-7-13-10/h9-10H,1-8H2.
What are the key properties of CID 142148322?
CID 142148322 has a molecular weight of 181.06 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142148322 is sourced from PubChem (CID 142148322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).