C15H23N3O6S — CID 138609416
[2-[3-[[(2S)-1,4-dioxan-2-yl]methoxymethyl]azetidin-1-yl]pyrimidin-4-yl]methyl methanesulfonate (PubChem CID 138609416) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-[3-[[(2S)-1,4-dioxan-2-yl]methoxymethyl]azetidin-1-yl]pyrimidin-4-yl]methyl methanesulfonate.
| Compound Name | [2-[3-[[(2S)-1,4-dioxan-2-yl]methoxymethyl]azetidin-1-yl]pyrimidin-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 138609416 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-[3-[[(2S)-1,4-dioxan-2-yl]methoxymethyl]azetidin-1-yl]pyrimidin-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccnc(N2CC(COC[C@H]3COCCO3)C2)n1 |
| InChI | InChI=1S/C15H23N3O6S/c1-25(19,20)24-9-13-2-3-16-15(17-13)18-6-12(7-18)8-22-11-14-10-21-4-5-23-14/h2-3,12,14H,4-11H2,1H3/t14-/m1/s1 |
| InChIKey | PRWMYLBBDIFXBB-CQSZACIVSA-N |
| XLogP | -0.18 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|