C11H15NO3 — CID 175366959
3-(1,4-dioxan-2-ylmethoxy)-4-methylpyridine (PubChem CID 175366959) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-ylmethoxy)-4-methylpyridine.
| Compound Name | 3-(1,4-dioxan-2-ylmethoxy)-4-methylpyridine |
|---|---|
| PubChem CID | 175366959 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-(1,4-dioxan-2-ylmethoxy)-4-methylpyridine |
| SMILES | Cc1ccncc1OCC1COCCO1 |
| InChI | InChI=1S/C11H15NO3/c1-9-2-3-12-6-11(9)15-8-10-7-13-4-5-14-10/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | UXUBNVUDELCAHA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |