C10H14BNO4 — CID 162342133
[3-(oxolan-2-ylmethoxy)-4-pyridinyl]boronic acid (PubChem CID 162342133) has the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxy)-4-pyridinyl]boronic acid.
| Compound Name | [3-(oxolan-2-ylmethoxy)-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 162342133 |
| Molecular Formula | C10H14BNO4 |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [3-(oxolan-2-ylmethoxy)-4-pyridinyl]boronic acid |
| SMILES | OB(O)c1ccncc1OCC1CCCO1 |
| InChI | InChI=1S/C10H14BNO4/c13-11(14)9-3-4-12-6-10(9)16-7-8-2-1-5-15-8/h3-4,6,8,13-14H,1-2,5,7H2 |
| InChIKey | JPWXPRNNBBHHNT-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|