C10H12BrNO2 — CID 90421245
4-bromo-3-(oxolan-3-ylmethoxy)pyridine (PubChem CID 90421245) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 4-bromo-3-(oxolan-3-ylmethoxy)pyridine.
| Compound Name | 4-bromo-3-(oxolan-3-ylmethoxy)pyridine |
|---|---|
| PubChem CID | 90421245 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 4-bromo-3-(oxolan-3-ylmethoxy)pyridine |
| SMILES | Brc1ccncc1OCC1CCOC1 |
| InChI | InChI=1S/C10H12BrNO2/c11-9-1-3-12-5-10(9)14-7-8-2-4-13-6-8/h1,3,5,8H,2,4,6-7H2 |
| InChIKey | VGNBMUAOPUUADL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |