C22H27N3O4 — CID 166243047
1-[[3-(oxolan-3-ylmethoxy)-4-pyridinyl]methyl]-3-(3-phenoxycyclobutyl)urea (PubChem CID 166243047) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[[3-(oxolan-3-ylmethoxy)-4-pyridinyl]methyl]-3-(3-phenoxycyclobutyl)urea.
| Compound Name | 1-[[3-(oxolan-3-ylmethoxy)-4-pyridinyl]methyl]-3-(3-phenoxycyclobutyl)urea |
|---|---|
| PubChem CID | 166243047 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[[3-(oxolan-3-ylmethoxy)-4-pyridinyl]methyl]-3-(3-phenoxycyclobutyl)urea |
| SMILES | O=C(NCc1ccncc1OCC1CCOC1)NC1CC(Oc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O4/c26-22(25-18-10-20(11-18)29-19-4-2-1-3-5-19)24-12-17-6-8-23-13-21(17)28-15-16-7-9-27-14-16/h1-6,8,13,16,18,20H,7,9-12,14-15H2,(H2,24,25,26) |
| InChIKey | BAHIQBNDTIKAIH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |