C11H15FN2O4 — CID 162687373
4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-fluoro-N-methoxypyridin-3-amine (PubChem CID 162687373) has the molecular formula C11H15FN2O4 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-fluoro-N-methoxypyridin-3-amine.
| Compound Name | 4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-fluoro-N-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 162687373 |
| Molecular Formula | C11H15FN2O4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-fluoro-N-methoxypyridin-3-amine |
| SMILES | CONc1cnc(F)cc1OC[C@H]1COCCO1 |
| InChI | InChI=1S/C11H15FN2O4/c1-15-14-9-5-13-11(12)4-10(9)18-7-8-6-16-2-3-17-8/h4-5,8,14H,2-3,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | AHUMENXVOLXLAJ-MRVPVSSYSA-N |
| XLogP | 0.99 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|