C17H16FN3O3 — CID 175883661
7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 175883661) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 175883661 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Fc1cc(OC[C@H]2COCCO2)c2[nH]cc(-c3ccccn3)c2n1 |
| InChI | InChI=1S/C17H16FN3O3/c18-15-7-14(24-10-11-9-22-5-6-23-11)17-16(21-15)12(8-20-17)13-3-1-2-4-19-13/h1-4,7-8,11,20H,5-6,9-10H2/t11-/m1/s1 |
| InChIKey | BINZHEWMNNCUEF-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|