About 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine
7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 175883661) has the molecular formula C17H16FN3O3
and a molecular weight of 329.33 g/mol. Its IUPAC name is 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 175883661 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Fc1cc(OC[C@H]2COCCO2)c2[nH]cc(-c3ccccn3)c2n1 |
| InChI | InChI=1S/C17H16FN3O3/c18-15-7-14(24-10-11-9-22-5-6-23-11)17-16(21-15)12(8-20-17)13-3-1-2-4-19-13/h1-4,7-8,11,20H,5-6,9-10H2/t11-/m1/s1 |
| InChIKey | BINZHEWMNNCUEF-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine (CID 175883661) is 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine is Fc1cc(OC[C@H]2COCCO2)c2[nH]cc(-c3ccccn3)c2n1.
What is the InChIKey of 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is BINZHEWMNNCUEF-LLVKDONJSA-N. The full InChI is InChI=1S/C17H16FN3O3/c18-15-7-14(24-10-11-9-22-5-6-23-11)17-16(21-15)12(8-20-17)13-3-1-2-4-19-13/h1-4,7-8,11,20H,5-6,9-10H2/t11-/m1/s1.
What are the key properties of 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine?
7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 329.33 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[(2R)-1,4-dioxan-2-yl]methoxy]-5-fluoro-3-pyridin-2-yl-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 175883661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).