C12H12FNO3 — CID 136542710
2-(1,4-dioxan-2-ylmethoxy)-6-fluorobenzonitrile (PubChem CID 136542710) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethoxy)-6-fluorobenzonitrile.
| Compound Name | 2-(1,4-dioxan-2-ylmethoxy)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 136542710 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethoxy)-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1OCC1COCCO1 |
| InChI | InChI=1S/C12H12FNO3/c13-11-2-1-3-12(10(11)6-14)17-8-9-7-15-4-5-16-9/h1-3,9H,4-5,7-8H2 |
| InChIKey | AZLYYXKPTOUOBH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |