C13H16FNO — CID 79513134
2-(3,3-dimethylbutoxy)-6-fluorobenzonitrile (PubChem CID 79513134) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-6-fluorobenzonitrile.
| Compound Name | 2-(3,3-dimethylbutoxy)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 79513134 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-6-fluorobenzonitrile |
| SMILES | CC(C)(C)CCOc1cccc(F)c1C#N |
| InChI | InChI=1S/C13H16FNO/c1-13(2,3)7-8-16-12-6-4-5-11(14)10(12)9-15/h4-6H,7-8H2,1-3H3 |
| InChIKey | QMKSHFOZTHWEHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |