C14H18FNO3 — CID 63629983
2-(3,3-diethoxypropoxy)-6-fluorobenzonitrile (PubChem CID 63629983) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-(3,3-diethoxypropoxy)-6-fluorobenzonitrile.
| Compound Name | 2-(3,3-diethoxypropoxy)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 63629983 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(3,3-diethoxypropoxy)-6-fluorobenzonitrile |
| SMILES | CCOC(CCOc1cccc(F)c1C#N)OCC |
| InChI | InChI=1S/C14H18FNO3/c1-3-17-14(18-4-2)8-9-19-13-7-5-6-12(15)11(13)10-16/h5-7,14H,3-4,8-9H2,1-2H3 |
| InChIKey | YRQZOOVBPRTBTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|