C17H16FNO3 — CID 69356379
2-[2-(3,5-dimethoxyphenyl)ethoxy]-6-fluorobenzonitrile (PubChem CID 69356379) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)ethoxy]-6-fluorobenzonitrile.
| Compound Name | 2-[2-(3,5-dimethoxyphenyl)ethoxy]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 69356379 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)ethoxy]-6-fluorobenzonitrile |
| SMILES | COc1cc(CCOc2cccc(F)c2C#N)cc(OC)c1 |
| InChI | InChI=1S/C17H16FNO3/c1-20-13-8-12(9-14(10-13)21-2)6-7-22-17-5-3-4-16(18)15(17)11-19/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | BXIQHFBNTLIVSK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |