C23H23ClN2O4 — CID 164856299
2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]pyridine (PubChem CID 164856299) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]pyridine.
| Compound Name | 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 164856299 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]pyridine |
| SMILES | Cc1cc(OCc2ccccn2)ccc1-c1cc(OCC2COCCO2)cc(Cl)n1 |
| InChI | InChI=1S/C23H23ClN2O4/c1-16-10-18(29-13-17-4-2-3-7-25-17)5-6-21(16)22-11-19(12-23(24)26-22)30-15-20-14-27-8-9-28-20/h2-7,10-12,20H,8-9,13-15H2,1H3 |
| InChIKey | JEUHFHGDKGGNIQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|