C11H14ClNO4 — CID 164856462
2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-methoxypyridine (PubChem CID 164856462) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-methoxypyridine.
| Compound Name | 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-methoxypyridine |
|---|---|
| PubChem CID | 164856462 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-chloro-4-(1,4-dioxan-2-ylmethoxy)-6-methoxypyridine |
| SMILES | COc1cc(OCC2COCCO2)cc(Cl)n1 |
| InChI | InChI=1S/C11H14ClNO4/c1-14-11-5-8(4-10(12)13-11)17-7-9-6-15-2-3-16-9/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | SBBTVBOPUTUQRR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|