C24H27NO4 — CID 167420574
2-[[4-(2-cyclopropylethynyl)phenyl]methoxy]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-ethylpyridine (PubChem CID 167420574) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[[4-(2-cyclopropylethynyl)phenyl]methoxy]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-ethylpyridine.
| Compound Name | 2-[[4-(2-cyclopropylethynyl)phenyl]methoxy]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-ethylpyridine |
|---|---|
| PubChem CID | 167420574 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[[4-(2-cyclopropylethynyl)phenyl]methoxy]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-ethylpyridine |
| SMILES | CCc1cc(OC[C@H]2COCCO2)cc(OCc2ccc(C#CC3CC3)cc2)n1 |
| InChI | InChI=1S/C24H27NO4/c1-2-21-13-22(28-17-23-16-26-11-12-27-23)14-24(25-21)29-15-20-9-7-19(8-10-20)6-5-18-3-4-18/h7-10,13-14,18,23H,2-4,11-12,15-17H2,1H3/t23-/m1/s1 |
| InChIKey | WRDYGYUEVJYKGV-HSZRJFAPSA-N |
| XLogP | 3.78 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|