C22H23NO4 — CID 164856136
1-[3-(2-cyclopropylethynyl)phenyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one (PubChem CID 164856136) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[3-(2-cyclopropylethynyl)phenyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one.
| Compound Name | 1-[3-(2-cyclopropylethynyl)phenyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 164856136 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[3-(2-cyclopropylethynyl)phenyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one |
| SMILES | Cc1cc(OCC2COCCO2)cc(=O)n1-c1cccc(C#CC2CC2)c1 |
| InChI | InChI=1S/C22H23NO4/c1-16-11-20(27-15-21-14-25-9-10-26-21)13-22(24)23(16)19-4-2-3-18(12-19)8-7-17-5-6-17/h2-4,11-13,17,21H,5-6,9-10,14-15H2,1H3 |
| InChIKey | MVOPEJWCFROHMR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|