C28H30N2O4 — CID 167420546
1-[[3-[3-(benzylamino)prop-1-ynyl]phenyl]methyl]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one (PubChem CID 167420546) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[[3-[3-(benzylamino)prop-1-ynyl]phenyl]methyl]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one.
| Compound Name | 1-[[3-[3-(benzylamino)prop-1-ynyl]phenyl]methyl]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 167420546 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[[3-[3-(benzylamino)prop-1-ynyl]phenyl]methyl]-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one |
| SMILES | Cc1cc(OC[C@H]2COCCO2)cc(=O)n1Cc1cccc(C#CCNCc2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O4/c1-22-15-26(34-21-27-20-32-13-14-33-27)17-28(31)30(22)19-25-10-5-9-23(16-25)11-6-12-29-18-24-7-3-2-4-8-24/h2-5,7-10,15-17,27,29H,12-14,18-21H2,1H3/t27-/m1/s1 |
| InChIKey | BGQSOTHHODEDBV-HHHXNRCGSA-N |
| XLogP | 3.14 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|