C24H27NO4 — CID 164856070
1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one (PubChem CID 164856070) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one.
| Compound Name | 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 164856070 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]-6-methylpyridin-2-one |
| SMILES | Cc1cc(OC[C@@H]2COCCO2)cc(=O)n1[C@H](C)c1ccc(C#CC2CC2)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-17-13-22(29-16-23-15-27-11-12-28-23)14-24(26)25(17)18(2)21-9-7-20(8-10-21)6-5-19-3-4-19/h7-10,13-14,18-19,23H,3-4,11-12,15-16H2,1-2H3/t18-,23+/m1/s1 |
| InChIKey | GRLQLPJQZWEUTF-JPYJTQIMSA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|