C25H29NO3 — CID 167420565
1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-6-methyl-4-[[(3R)-oxan-3-yl]methoxy]pyridin-2-one (PubChem CID 167420565) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-6-methyl-4-[[(3R)-oxan-3-yl]methoxy]pyridin-2-one.
| Compound Name | 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-6-methyl-4-[[(3R)-oxan-3-yl]methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 167420565 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-[(1R)-1-[4-(2-cyclopropylethynyl)phenyl]ethyl]-6-methyl-4-[[(3R)-oxan-3-yl]methoxy]pyridin-2-one |
| SMILES | Cc1cc(OC[C@@H]2CCCOC2)cc(=O)n1[C@H](C)c1ccc(C#CC2CC2)cc1 |
| InChI | InChI=1S/C25H29NO3/c1-18-14-24(29-17-22-4-3-13-28-16-22)15-25(27)26(18)19(2)23-11-9-21(10-12-23)8-7-20-5-6-20/h9-12,14-15,19-20,22H,3-6,13,16-17H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | CFUCEKLEXXXTLZ-DENIHFKCSA-N |
| XLogP | 4.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|