C23H25NO4 — CID 167175823
1-[[4-(2-cyclopropylethynyl)-2-methylphenyl]methyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]pyridin-2-one (PubChem CID 167175823) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[[4-(2-cyclopropylethynyl)-2-methylphenyl]methyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]pyridin-2-one.
| Compound Name | 1-[[4-(2-cyclopropylethynyl)-2-methylphenyl]methyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 167175823 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[[4-(2-cyclopropylethynyl)-2-methylphenyl]methyl]-4-[[(2S)-1,4-dioxan-2-yl]methoxy]pyridin-2-one |
| SMILES | Cc1cc(C#CC2CC2)ccc1Cn1ccc(OC[C@@H]2COCCO2)cc1=O |
| InChI | InChI=1S/C23H25NO4/c1-17-12-19(5-4-18-2-3-18)6-7-20(17)14-24-9-8-21(13-23(24)25)28-16-22-15-26-10-11-27-22/h6-9,12-13,18,22H,2-3,10-11,14-16H2,1H3/t22-/m0/s1 |
| InChIKey | QNYJIJDFSYQXBV-QFIPXVFZSA-N |
| XLogP | 2.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|