C22H24N2O4 — CID 164856021
1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyrimidin-2-one (PubChem CID 164856021) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyrimidin-2-one.
| Compound Name | 1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 164856021 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyrimidin-2-one |
| SMILES | Cc1cc(OCC2COCCO2)nc(=O)n1Cc1ccc(C#CC2CC2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-16-12-21(28-15-20-14-26-10-11-27-20)23-22(25)24(16)13-19-8-6-18(7-9-19)5-4-17-2-3-17/h6-9,12,17,20H,2-3,10-11,13-15H2,1H3 |
| InChIKey | SUZMBHNUYGBQGH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|