C25H29NO4 — CID 164856471
1-[1-[4-(2-cyclopropylethynyl)phenyl]propyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one (PubChem CID 164856471) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[1-[4-(2-cyclopropylethynyl)phenyl]propyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one.
| Compound Name | 1-[1-[4-(2-cyclopropylethynyl)phenyl]propyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 164856471 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-[1-[4-(2-cyclopropylethynyl)phenyl]propyl]-4-(1,4-dioxan-2-ylmethoxy)-6-methylpyridin-2-one |
| SMILES | CCC(c1ccc(C#CC2CC2)cc1)n1c(C)cc(OCC2COCCO2)cc1=O |
| InChI | InChI=1S/C25H29NO4/c1-3-24(21-10-8-20(9-11-21)7-6-19-4-5-19)26-18(2)14-22(15-25(26)27)30-17-23-16-28-12-13-29-23/h8-11,14-15,19,23-24H,3-5,12-13,16-17H2,1-2H3 |
| InChIKey | DSQUDEHGRSSBRO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|