C26H25ClN2O3 — CID 167420520
N-[3-[4-[6-chloro-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-2-pyridinyl]-3-methylphenyl]prop-2-ynyl]aniline (PubChem CID 167420520) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is N-[3-[4-[6-chloro-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-2-pyridinyl]-3-methylphenyl]prop-2-ynyl]aniline.
| Compound Name | N-[3-[4-[6-chloro-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-2-pyridinyl]-3-methylphenyl]prop-2-ynyl]aniline |
|---|---|
| PubChem CID | 167420520 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-[4-[6-chloro-4-[[(2R)-1,4-dioxan-2-yl]methoxy]-2-pyridinyl]-3-methylphenyl]prop-2-ynyl]aniline |
| SMILES | Cc1cc(C#CCNc2ccccc2)ccc1-c1cc(OC[C@H]2COCCO2)cc(Cl)n1 |
| InChI | InChI=1S/C26H25ClN2O3/c1-19-14-20(6-5-11-28-21-7-3-2-4-8-21)9-10-24(19)25-15-22(16-26(27)29-25)32-18-23-17-30-12-13-31-23/h2-4,7-10,14-16,23,28H,11-13,17-18H2,1H3/t23-/m1/s1 |
| InChIKey | PXSSJSQYYMNPFJ-HSZRJFAPSA-N |
| XLogP | 4.97 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|