C27H29ClN2O5 — CID 166529846
2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethanamine;hydrochloride (PubChem CID 166529846) has the molecular formula C27H29ClN2O5 and a molecular weight of 496.99 g/mol. Its IUPAC name is 2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethanamine;hydrochloride.
| Compound Name | 2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 166529846 |
| Molecular Formula | C27H29ClN2O5 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethanamine;hydrochloride |
| SMILES | Cl.NCCOc1ccc(C#Cc2cc(OCc3ccccc3)cc(OCC3COCCO3)n2)cc1 |
| InChI | InChI=1S/C27H28N2O5.ClH/c28-12-13-31-24-10-7-21(8-11-24)6-9-23-16-25(33-18-22-4-2-1-3-5-22)17-27(29-23)34-20-26-19-30-14-15-32-26;/h1-5,7-8,10-11,16-17,26H,12-15,18-20,28H2;1H |
| InChIKey | ZQUDMWICYGHLKT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|