C34H40N2O7 — CID 166529886
tert-butyl N-[2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethyl]carbamate (PubChem CID 166529886) has the molecular formula C34H40N2O7 and a molecular weight of 588.70 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166529886 |
| Molecular Formula | C34H40N2O7 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | tert-butyl N-[2-[4-[2-[6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-4-phenylmethoxy-2-pyridinyl]ethynyl]phenoxy]ethyl]carbamate |
| SMILES | CCc1c(OCc2ccccc2)cc(OCC2COCCO2)nc1C#Cc1ccc(OCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H40N2O7/c1-5-29-30(16-13-25-11-14-27(15-12-25)39-18-17-35-33(37)43-34(2,3)4)36-32(42-24-28-23-38-19-20-40-28)21-31(29)41-22-26-9-7-6-8-10-26/h6-12,14-15,21,28H,5,17-20,22-24H2,1-4H3,(H,35,37) |
| InChIKey | AYENGNVQQWQCBI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|