C37H38F3NO4 — CID 145199731
tert-butyl N-[2-[4-[(Z)-1-(4-phenylmethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]but-1-enyl]phenoxy]ethyl]carbamate (PubChem CID 145199731) has the molecular formula C37H38F3NO4 and a molecular weight of 617.71 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(Z)-1-(4-phenylmethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]but-1-enyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(Z)-1-(4-phenylmethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]but-1-enyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 145199731 |
| Molecular Formula | C37H38F3NO4 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | tert-butyl N-[2-[4-[(Z)-1-(4-phenylmethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]but-1-enyl]phenoxy]ethyl]carbamate |
| SMILES | CC/C(=C(/c1ccc(OCCNC(=O)OC(C)(C)C)cc1)c1ccc(OCc2ccccc2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C37H38F3NO4/c1-5-33(27-11-17-30(18-12-27)37(38,39)40)34(29-15-21-32(22-16-29)44-25-26-9-7-6-8-10-26)28-13-19-31(20-14-28)43-24-23-41-35(42)45-36(2,3)4/h6-22H,5,23-25H2,1-4H3,(H,41,42)/b34-33+ |
| InChIKey | MHJHPEYHZUGGFM-JEIPZWNWSA-N |
| XLogP | 9.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|