C36H29F3O2 — CID 140928916
1-phenylmethoxy-4-[(Z)-2-phenyl-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]but-1-enyl]benzene (PubChem CID 140928916) has the molecular formula C36H29F3O2 and a molecular weight of 550.62 g/mol. Its IUPAC name is 1-phenylmethoxy-4-[(Z)-2-phenyl-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]but-1-enyl]benzene.
| Compound Name | 1-phenylmethoxy-4-[(Z)-2-phenyl-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]but-1-enyl]benzene |
|---|---|
| PubChem CID | 140928916 |
| Molecular Formula | C36H29F3O2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 1-phenylmethoxy-4-[(Z)-2-phenyl-1-[4-[4-(trifluoromethyl)phenoxy]phenyl]but-1-enyl]benzene |
| SMILES | CC/C(=C(\c1ccc(OCc2ccccc2)cc1)c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H29F3O2/c1-2-34(27-11-7-4-8-12-27)35(28-13-19-31(20-14-28)40-25-26-9-5-3-6-10-26)29-15-21-32(22-16-29)41-33-23-17-30(18-24-33)36(37,38)39/h3-24H,2,25H2,1H3/b35-34- |
| InChIKey | AFKSKRYLOITIKB-KNWKATPGSA-N |
| XLogP | 10.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|