C33H33NO2 — CID 127048622
2-methyl-N-[4-[(Z)-1-phenyl-2-(4-phenylmethoxyphenyl)but-1-enyl]phenyl]propanamide (PubChem CID 127048622) has the molecular formula C33H33NO2 and a molecular weight of 475.63 g/mol. Its IUPAC name is 2-methyl-N-[4-[(Z)-1-phenyl-2-(4-phenylmethoxyphenyl)but-1-enyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[(Z)-1-phenyl-2-(4-phenylmethoxyphenyl)but-1-enyl]phenyl]propanamide |
|---|---|
| PubChem CID | 127048622 |
| Molecular Formula | C33H33NO2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-methyl-N-[4-[(Z)-1-phenyl-2-(4-phenylmethoxyphenyl)but-1-enyl]phenyl]propanamide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(NC(=O)C(C)C)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33NO2/c1-4-31(26-17-21-30(22-18-26)36-23-25-11-7-5-8-12-25)32(27-13-9-6-10-14-27)28-15-19-29(20-16-28)34-33(35)24(2)3/h5-22,24H,4,23H2,1-3H3,(H,34,35)/b32-31- |
| InChIKey | WFCKQEUCJOQUCE-MVJHLKBCSA-N |
| XLogP | 8.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|