C35H40FN3O4 — CID 175353524
tert-butyl N-[2-[4-[1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl]carbamate (PubChem CID 175353524) has the molecular formula C35H40FN3O4 and a molecular weight of 585.72 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 175353524 |
| Molecular Formula | C35H40FN3O4 |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | tert-butyl N-[2-[4-[1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl]carbamate |
| SMILES | CCC(=C(c1ccc(OCCNC(=O)OC(C)(C)C)cc1)c1ccc2c(c1)c(F)nn2C1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C35H40FN3O4/c1-5-28(24-11-7-6-8-12-24)32(25-14-17-27(18-15-25)41-22-20-37-34(40)43-35(2,3)4)26-16-19-30-29(23-26)33(36)38-39(30)31-13-9-10-21-42-31/h6-8,11-12,14-19,23,31H,5,9-10,13,20-22H2,1-4H3,(H,37,40) |
| InChIKey | NUKVYNPCZDLIEV-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|