C35H39F2N3O4 — CID 172851590
[2-[3-fluoro-4-[(Z)-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]-3,3-dimethylbutyl] carbamate (PubChem CID 172851590) has the molecular formula C35H39F2N3O4 and a molecular weight of 603.71 g/mol. Its IUPAC name is [2-[3-fluoro-4-[(Z)-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]-3,3-dimethylbutyl] carbamate.
| Compound Name | [2-[3-fluoro-4-[(Z)-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]-3,3-dimethylbutyl] carbamate |
|---|---|
| PubChem CID | 172851590 |
| Molecular Formula | C35H39F2N3O4 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | [2-[3-fluoro-4-[(Z)-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]-3,3-dimethylbutyl] carbamate |
| SMILES | CC/C(=C(\c1ccc2c(c1)c(F)nn2C1CCCCO1)c1ccc(OC(COC(N)=O)C(C)(C)C)cc1F)c1ccccc1 |
| InChI | InChI=1S/C35H39F2N3O4/c1-5-25(22-11-7-6-8-12-22)32(23-14-17-29-27(19-23)33(37)39-40(29)31-13-9-10-18-42-31)26-16-15-24(20-28(26)36)44-30(35(2,3)4)21-43-34(38)41/h6-8,11-12,14-17,19-20,30-31H,5,9-10,13,18,21H2,1-4H3,(H2,38,41)/b32-25- |
| InChIKey | YDJFNPFXFZCNAB-MKCFTUBBSA-N |
| XLogP | 8.27 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|