C30H28F4N4O4 — CID 134519334
2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl carbamate (PubChem CID 134519334) has the molecular formula C30H28F4N4O4 and a molecular weight of 584.57 g/mol. Its IUPAC name is 2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl carbamate.
| Compound Name | 2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl carbamate |
|---|---|
| PubChem CID | 134519334 |
| Molecular Formula | C30H28F4N4O4 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl carbamate |
| SMILES | NC(=O)OCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C30H28F4N4O4/c31-28-22-16-20(9-11-24(22)38(37-28)26-8-4-5-13-41-26)27(23(17-30(32,33)34)19-6-2-1-3-7-19)21-10-12-25(36-18-21)40-14-15-42-29(35)39/h1-3,6-7,9-12,16,18,26H,4-5,8,13-15,17H2,(H2,35,39)/b27-23- |
| InChIKey | IZRGZEONQBRTRU-VYIQYICTSA-N |
| XLogP | 6.66 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|