C37H39F4N5O3 — CID 155430037
(E)-N-methyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155430037) has the molecular formula C37H39F4N5O3 and a molecular weight of 677.74 g/mol. Its IUPAC name is (E)-N-methyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-methyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155430037 |
| Molecular Formula | C37H39F4N5O3 |
| Molecular Weight | 677.74 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | (E)-N-methyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | CNC(=O)/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4c(c3)c(F)nn4C3CCCCO3)cn2)C1 |
| InChI | InChI=1S/C37H39F4N5O3/c1-42-32(47)12-8-19-45-18-7-11-28(24-45)49-33-17-15-27(23-43-33)35(30(22-37(39,40)41)25-9-3-2-4-10-25)26-14-16-31-29(21-26)36(38)44-46(31)34-13-5-6-20-48-34/h2-4,8-10,12,14-17,21,23,28,34H,5-7,11,13,18-20,22,24H2,1H3,(H,42,47)/b12-8+,35-30-/t28-,34?/m1/s1 |
| InChIKey | LPICXAWDIAHCMI-AKQRTDPESA-N |
| XLogP | 7.33 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|