C38H41F4N5O3 — CID 163282649
(E)-N,N-dimethyl-4-[(3S)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 163282649) has the molecular formula C38H41F4N5O3 and a molecular weight of 691.77 g/mol. Its IUPAC name is (E)-N,N-dimethyl-4-[(3S)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N,N-dimethyl-4-[(3S)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 163282649 |
| Molecular Formula | C38H41F4N5O3 |
| Molecular Weight | 691.77 g/mol |
| Exact Mass | 691.31 |
| IUPAC Name | (E)-N,N-dimethyl-4-[(3S)-3-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CN1CCC[C@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4c(c3)c(F)nn4C3CCCCO3)cn2)C1 |
| InChI | InChI=1S/C38H41F4N5O3/c1-45(2)34(48)13-9-20-46-19-8-12-29(25-46)50-33-18-16-28(24-43-33)36(31(23-38(40,41)42)26-10-4-3-5-11-26)27-15-17-32-30(22-27)37(39)44-47(32)35-14-6-7-21-49-35/h3-5,9-11,13,15-18,22,24,29,35H,6-8,12,14,19-21,23,25H2,1-2H3/b13-9+,36-31-/t29-,35?/m0/s1 |
| InChIKey | JLUIYDOIIRRLNS-ICXGMKOBSA-N |
| XLogP | 7.67 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|