C33H33F4N5O2 — CID 175200582
N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 175200582) has the molecular formula C33H33F4N5O2 and a molecular weight of 607.65 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 175200582 |
| Molecular Formula | C33H33F4N5O2 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | N,N-dimethyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | CN(C)C(=O)C=CCN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1 |
| InChI | InChI=1S/C33H33F4N5O2/c1-41(2)30(43)11-7-17-42-16-6-10-25(21-42)44-29-15-13-24(20-38-29)31(23-12-14-28-26(18-23)32(34)40-39-28)27(19-33(35,36)37)22-8-4-3-5-9-22/h3-5,7-9,11-15,18,20,25H,6,10,16-17,19,21H2,1-2H3,(H,39,40)/b11-7?,31-27-/t25-/m1/s1 |
| InChIKey | FHVKFKBORUYFSG-OYYIVYAQSA-N |
| XLogP | 6.50 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|