C16H22IN3O2 — CID 163282640
4-[3-[(5-iodo-2-pyridinyl)oxy]piperidin-1-yl]-N,N-dimethylbut-2-enamide (PubChem CID 163282640) has the molecular formula C16H22IN3O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is 4-[3-[(5-iodo-2-pyridinyl)oxy]piperidin-1-yl]-N,N-dimethylbut-2-enamide.
| Compound Name | 4-[3-[(5-iodo-2-pyridinyl)oxy]piperidin-1-yl]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 163282640 |
| Molecular Formula | C16H22IN3O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-[3-[(5-iodo-2-pyridinyl)oxy]piperidin-1-yl]-N,N-dimethylbut-2-enamide |
| SMILES | CN(C)C(=O)C=CCN1CCCC(Oc2ccc(I)cn2)C1 |
| InChI | InChI=1S/C16H22IN3O2/c1-19(2)16(21)6-4-10-20-9-3-5-14(12-20)22-15-8-7-13(17)11-18-15/h4,6-8,11,14H,3,5,9-10,12H2,1-2H3 |
| InChIKey | GWDYASWGBPOGOB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|